Difference between revisions of "SJ08228"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-725 CPD-725] == * common-name: ** 13(s)-hpote * smiles: ** ccc=ccc(c=cc=ccccccccc([o-])=o)o...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11641 CPD-11641] == * common-name: ** 4-methylumbelliferyl glucoside * smiles: ** cc3(c2(c=...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11641 CPD-11641] == |
* common-name: | * common-name: | ||
| − | ** | + | ** 4-methylumbelliferyl glucoside |
* smiles: | * smiles: | ||
| − | ** | + | ** cc3(c2(c=cc(oc1(oc(co)c(o)c(o)c(o)1))=cc=2oc(=o)c=3)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** yudptgpsbjvhcn-ymiltqatsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 338.313 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-10769]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=4-methylumbelliferyl glucoside}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=yudptgpsbjvhcn-ymiltqatsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=338.313}} |
Revision as of 14:20, 26 August 2019
Contents
Metabolite CPD-11641
- common-name:
- 4-methylumbelliferyl glucoside
- smiles:
- cc3(c2(c=cc(oc1(oc(co)c(o)c(o)c(o)1))=cc=2oc(=o)c=3))
- inchi-key:
- yudptgpsbjvhcn-ymiltqatsa-n
- molecular-weight:
- 338.313
