Difference between revisions of "SJ08230"

Revision as of 09:24, 27 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17373 CPD-17373] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Nucleosides Nucleosides] ==
 * common-name:
-** 1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol 3-phosphate
+** a nucleoside
-* smiles:
-** c(o)cccccccc=ccccccccc(occ(oc(=o)cccccccc=ccc=cccccco)cop([o-])(=o)[o-])=o
-* inchi-key:
-** zxbgeihfxphrjy-nkfdzxfusa-l
-* molecular-weight:
-** 728.942
 == Reaction(s) known to consume the compound ==
-* [[RXN-16121]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-16118]]
+* [[NUCLEOTIDASE-RXN]]
+* [[RXN-14473]]
+* [[RXN-17947]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol 3-phosphate}}
+{{#set: common-name=a nucleoside}}
-{{#set: inchi-key=inchikey=zxbgeihfxphrjy-nkfdzxfusa-l}}
-{{#set: molecular-weight=728.942}}