Difference between revisions of "SJ08249"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11878 CPD-11878] == * common-name: ** 3,4-dihydroxyphenylglycol * smiles: ** c(o)c(o)c1(c=c...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-Acyl-pyruvates 3-Acyl-pyruvates] == * common-name: ** a 3-acylpyruvate == Reaction(s) known t...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11878 CPD-11878] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-Acyl-pyruvates 3-Acyl-pyruvates] ==
 
* common-name:
 
* common-name:
** 3,4-dihydroxyphenylglycol
+
** a 3-acylpyruvate
* smiles:
 
** c(o)c(o)c1(c=cc(o)=c(o)c=1)
 
* inchi-key:
 
** mtvwfvdwrvydor-qmmmgpobsa-n
 
* molecular-weight:
 
** 170.165
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[ACYLPYRUVATE-HYDROLASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10911]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3,4-dihydroxyphenylglycol}}
+
{{#set: common-name=a 3-acylpyruvate}}
{{#set: inchi-key=inchikey=mtvwfvdwrvydor-qmmmgpobsa-n}}
 
{{#set: molecular-weight=170.165}}
 

Revision as of 14:19, 26 August 2019

Metabolite 3-Acyl-pyruvates

  • common-name:
    • a 3-acylpyruvate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality