Difference between revisions of "SJ08265"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19155 CPD-19155] == * common-name: ** (s)-3-hydroxy-(9z)-hexadecenoyl-coa * smiles: ** cccc...")
(Created page with "Category:gene == Gene SJ08265 == * transcription-direction: ** positive * right-end-position: ** 45849 * left-end-position: ** 31454 * centisome-position: ** 7.088114...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19155 CPD-19155] ==
+
== Gene SJ08265 ==
* common-name:
+
* transcription-direction:
** (s)-3-hydroxy-(9z)-hexadecenoyl-coa
+
** positive
* smiles:
+
* right-end-position:
** ccccccc=ccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** 45849
* inchi-key:
+
* left-end-position:
** zirsqpaphgzdil-vscxgisksa-j
+
** 31454
* molecular-weight:
+
* centisome-position:
** 1015.898
+
** 7.088114   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[RXN-17790]]
+
* [[S.japonica_carotenoid_curated]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
* [[RXN-17789]]
+
* [[5.3.4.1-RXN]]
== Reaction(s) of unknown directionality ==
+
** Category: [[annotation]]
{{#set: common-name=(s)-3-hydroxy-(9z)-hexadecenoyl-coa}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: inchi-key=inchikey=zirsqpaphgzdil-vscxgisksa-j}}
+
* [[DISULISOM-RXN]]
{{#set: molecular-weight=1015.898}}
+
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=45849}}
 +
{{#set: left-end-position=31454}}
 +
{{#set: centisome-position=7.088114    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=2}}

Latest revision as of 11:03, 18 March 2021

Gene SJ08265

  • transcription-direction:
    • positive
  • right-end-position:
    • 45849
  • left-end-position:
    • 31454
  • centisome-position:
    • 7.088114

Organism(s) associated with this gene

Reaction(s) associated