Difference between revisions of "SJ08362"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PARAOXON PARAOXON] == * common-name: ** paraoxon * smiles: ** ccop(oc1(c=cc(=cc=1)[n+]([o-])=o)...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SINAPATE SINAPATE] == * common-name: ** sinapate * smiles: ** coc1(c=c(c=c(oc)c(o)=1)c=cc([o-])...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PARAOXON PARAOXON] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SINAPATE SINAPATE] ==
 
* common-name:
 
* common-name:
** paraoxon
+
** sinapate
 
* smiles:
 
* smiles:
** ccop(oc1(c=cc(=cc=1)[n+]([o-])=o))(occ)=o
+
** coc1(c=c(c=c(oc)c(o)=1)c=cc([o-])=o)
 
* inchi-key:
 
* inchi-key:
** wymsbxtxohuigt-uhfffaoysa-n
+
** pcmortlopmlefb-onegzznksa-m
 
* molecular-weight:
 
* molecular-weight:
** 275.197
+
** 223.205
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8746]]
+
* [[RXN-10919]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-3422]]
 +
* [[RXN-8014]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=paraoxon}}
+
{{#set: common-name=sinapate}}
{{#set: inchi-key=inchikey=wymsbxtxohuigt-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=pcmortlopmlefb-onegzznksa-m}}
{{#set: molecular-weight=275.197}}
+
{{#set: molecular-weight=223.205}}

Revision as of 09:24, 27 August 2019

Metabolite SINAPATE

  • common-name:
    • sinapate
  • smiles:
    • coc1(c=c(c=c(oc)c(o)=1)c=cc([o-])=o)
  • inchi-key:
    • pcmortlopmlefb-onegzznksa-m
  • molecular-weight:
    • 223.205

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality