Difference between revisions of "SJ08401"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11527 CPD-11527] == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3r-hydroxyb...")
(Created page with "Category:gene == Gene SJ08401 == * transcription-direction: ** negative * right-end-position: ** 34829 * left-end-position: ** 33504 * centisome-position: ** 62.03755...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11527 CPD-11527] ==
+
== Gene SJ08401 ==
−
* common-name:
+
* transcription-direction:
−
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3r-hydroxybutanoyl)-coa
+
** negative
−
* smiles:
+
* right-end-position:
−
** ccc=ccc1(c(ccc(=o)1)cc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])
+
** 34829
−
* inchi-key:
+
* left-end-position:
−
** yufhotsrmdfgns-gbypgrtbsa-j
+
** 33504
−
* molecular-weight:
+
* centisome-position:
−
** 999.813
+
** 62.03755   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[RXN-10703]]
+
* [[S.japonica_carotenoid_curated]]
−
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
−
* [[RXN-10705]]
+
* [[RNA-DIRECTED-DNA-POLYMERASE-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Category: [[annotation]]
−
{{#set: common-name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3r-hydroxybutanoyl)-coa}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
{{#set: inchi-key=inchikey=yufhotsrmdfgns-gbypgrtbsa-j}}
+
{{#set: transcription-direction=negative}}
−
{{#set: molecular-weight=999.813}}
+
{{#set: right-end-position=34829}}
 +
{{#set: left-end-position=33504}}
 +
{{#set: centisome-position=62.03755    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=1}}

Latest revision as of 11:03, 18 March 2021

Gene SJ08401

  • transcription-direction:
    • negative
  • right-end-position:
    • 34829
  • left-end-position:
    • 33504
  • centisome-position:
    • 62.03755

Organism(s) associated with this gene

Reaction(s) associated




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ08401&oldid=132810"