Difference between revisions of "SJ08424"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PROTEIN-C-TERMINAL-S-ETC-CYSTEINE PROTEIN-C-TERMINAL-S-ETC-CYSTEINE] == * common-name: ** a [pr...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13533 CPD-13533] == * common-name: ** (3r)-3-hydroxypentanoyl-coa * smiles: ** ccc(cc(sccnc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PROTEIN-C-TERMINAL-S-ETC-CYSTEINE PROTEIN-C-TERMINAL-S-ETC-CYSTEINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13533 CPD-13533] ==
 
* common-name:
 
* common-name:
** a [protein] c-terminal s-farnesyl-l-cysteine
+
** (3r)-3-hydroxypentanoyl-coa
 +
* smiles:
 +
** ccc(cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=o)o)n3(c=nc2(c(=nc=nc=23)n))))([o-])=o)(c)c)o)=o)=o)=o)o
 +
* inchi-key:
 +
** yygypcrwzmlsgk-orumcernsa-j
 +
* molecular-weight:
 +
** 863.619
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.1.1.100-RXN]]
+
* [[RXN-12560]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11698]]
 
* [[RXN-8409]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a [protein] c-terminal s-farnesyl-l-cysteine}}
+
{{#set: common-name=(3r)-3-hydroxypentanoyl-coa}}
 +
{{#set: inchi-key=inchikey=yygypcrwzmlsgk-orumcernsa-j}}
 +
{{#set: molecular-weight=863.619}}

Revision as of 09:23, 27 August 2019

Metabolite CPD-13533

  • common-name:
    • (3r)-3-hydroxypentanoyl-coa
  • smiles:
    • ccc(cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=o)o)n3(c=nc2(c(=nc=nc=23)n))))([o-])=o)(c)c)o)=o)=o)=o)o
  • inchi-key:
    • yygypcrwzmlsgk-orumcernsa-j
  • molecular-weight:
    • 863.619

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality