Difference between revisions of "SJ08442"

Revision as of 14:19, 26 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-METHYL-RS-TETRAHYDROBENZYLISOQUINOL N-METHYL-RS-TETRAHYDROBENZYLISOQUINOL] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Guanine37-in-tRNA Guanine37-in-tRNA] ==
 * common-name:
-** n-methyl-(r,s)-tetrahydrobenzylisoquinoline
+** a guanine37 in trna
-* smiles:
-** c[n+]1(c(c2(c(cc1)=cc=cc=2))cc3(c=cc=cc=3))
-* inchi-key:
-** vkrkvllltihdef-uhfffaoysa-o
-* molecular-weight:
-** 238.352
 == Reaction(s) known to consume the compound ==
+* [[RXN-12458]]
 == Reaction(s) known to produce the compound ==
-* [[2.1.1.115-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=n-methyl-(r,s)-tetrahydrobenzylisoquinoline}}
+{{#set: common-name=a guanine37 in trna}}
-{{#set: inchi-key=inchikey=vkrkvllltihdef-uhfffaoysa-o}}
-{{#set: molecular-weight=238.352}}