Difference between revisions of "SJ08477"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14736 CPD-14736] == * common-name: ** l-kynurenine * smiles: ** c(=o)([o-])c([n+])cc(=o)c1(...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8653 CPD-8653] == * common-name: ** betanidin * smiles: ** c(=[n+]1(c(c([o-])=o)cc2(=c1c=c(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8653 CPD-8653] == |
* common-name: | * common-name: | ||
| − | ** | + | ** betanidin |
* smiles: | * smiles: | ||
| − | ** c(= | + | ** c(=[n+]1(c(c([o-])=o)cc2(=c1c=c(o)c(o)=c2)))c=c3(c=c(c(=o)[o-])nc(c([o-])=o)c3) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** xhjkhsxhwjcblx-aaeuagobsa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 386.317 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-8635]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=betanidin}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=xhjkhsxhwjcblx-aaeuagobsa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=386.317}} |
Revision as of 09:24, 27 August 2019
Contents
Metabolite CPD-8653
- common-name:
- betanidin
- smiles:
- c(=[n+]1(c(c([o-])=o)cc2(=c1c=c(o)c(o)=c2)))c=c3(c=c(c(=o)[o-])nc(c([o-])=o)c3)
- inchi-key:
- xhjkhsxhwjcblx-aaeuagobsa-l
- molecular-weight:
- 386.317
