Difference between revisions of "SJ08508"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-METHYL-MYO-INOSITOL 4-METHYL-MYO-INOSITOL] == * common-name: ** d-ononitol * smiles: ** coc1(...")
(Created page with "Category:gene == Gene SJ08508 == * transcription-direction: ** negative * right-end-position: ** 17135 * left-end-position: ** 3818 * centisome-position: ** 7.3067575...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-METHYL-MYO-INOSITOL 4-METHYL-MYO-INOSITOL] ==
+
== Gene SJ08508 ==
* common-name:
+
* transcription-direction:
** d-ononitol
+
** negative
* smiles:
+
* right-end-position:
** coc1(c(o)c(o)c(o)c(o)c(o)1)
+
** 17135
* inchi-key:
+
* left-end-position:
** dscffeyyqksrsv-geskjzqwsa-n
+
** 3818
* molecular-weight:
+
* centisome-position:
** 194.184
+
** 7.3067575   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[RXN-8281]]
+
* [[S.japonica_carotenoid_curated]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
== Reaction(s) of unknown directionality ==
+
* [[3.1.3.16-RXN]]
{{#set: common-name=d-ononitol}}
+
** Category: [[annotation]]
{{#set: inchi-key=inchikey=dscffeyyqksrsv-geskjzqwsa-n}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: molecular-weight=194.184}}
+
* [[4-NITROPHENYLPHOSPHATASE-RXN]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
* [[PROTEIN-TYROSINE-PHOSPHATASE-RXN]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=17135}}
 +
{{#set: left-end-position=3818}}
 +
{{#set: centisome-position=7.3067575    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=3}}

Latest revision as of 11:01, 18 March 2021

Gene SJ08508

  • transcription-direction:
    • negative
  • right-end-position:
    • 17135
  • left-end-position:
    • 3818
  • centisome-position:
    • 7.3067575

Organism(s) associated with this gene

Reaction(s) associated