Difference between revisions of "SJ08543"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2106 CPD0-2106] == * common-name: ** 3-oxooctanoyl-coa * smiles: ** cccccc(=o)cc(=o)sccnc(...")
 
(Created page with "Category:gene == Gene SJ08543 == * transcription-direction: ** positive * right-end-position: ** 281621 * left-end-position: ** 252996 * centisome-position: ** 57.86469...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2106 CPD0-2106] ==
+
== Gene SJ08543 ==
* common-name:
+
* transcription-direction:
** 3-oxooctanoyl-coa
+
** positive
* smiles:
+
* right-end-position:
** cccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** 281621
* inchi-key:
+
* left-end-position:
** wpivbcgrgvnddt-cecatxlmsa-j
+
** 252996
* molecular-weight:
+
* centisome-position:
** 903.684
+
** 57.86469   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[RXN-13279-CPD-14916/NADP//CPD0-2106/NADPH/PROTON.39.]]
+
* [[S.japonica_carotenoid_curated]]
* [[RXN-14277]]
+
== Reaction(s) associated ==
== Reaction(s) known to produce the compound ==
+
* [[RXN66-482]]
* [[RXN-13279-CPD-14916/NADP//CPD0-2106/NADPH/PROTON.39.]]
+
** Category: [[annotation]]
* [[RXN-14275]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[RXN-14277]]
+
** Category: [[orthology]]
== Reaction(s) of unknown directionality ==
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
{{#set: common-name=3-oxooctanoyl-coa}}
+
* [[TRANSENOYLCOARED-RXN]]
{{#set: inchi-key=inchikey=wpivbcgrgvnddt-cecatxlmsa-j}}
+
** Category: [[annotation]]
{{#set: molecular-weight=903.684}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
** Category: [[orthology]]
 +
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
== Pathway(s) associated ==
 +
* [[PWY66-389]]
 +
** '''4''' reactions found over '''4''' reactions in the full pathway
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=281621}}
 +
{{#set: left-end-position=252996}}
 +
{{#set: centisome-position=57.86469    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=2}}
 +
{{#set: nb pathway associated=1}}

Latest revision as of 11:01, 18 March 2021

Gene SJ08543

  • transcription-direction:
    • positive
  • right-end-position:
    • 281621
  • left-end-position:
    • 252996
  • centisome-position:
    • 57.86469

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY66-389
    • 4 reactions found over 4 reactions in the full pathway