Difference between revisions of "SJ08543"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1137 CPD-1137] == * common-name: ** itaconyl-coa * smiles: ** c=c(cc(sccnc(=o)ccnc(=o)c(o)c...")
(Created page with "Category:gene == Gene SJ21402 == * transcription-direction: ** negative * right-end-position: ** 51173 * left-end-position: ** 41872 * centisome-position: ** 21.6281 =...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1137 CPD-1137] ==
+
== Gene SJ21402 ==
* common-name:
+
* transcription-direction:
** itaconyl-coa
+
** negative
* smiles:
+
* right-end-position:
** c=c(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)c([o-])=o
+
** 51173
* inchi-key:
+
* left-end-position:
** nfvgylgssjprkw-citakdkdsa-i
+
** 41872
* molecular-weight:
+
* centisome-position:
** 874.579
+
** 21.6281   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
== Reaction(s) known to produce the compound ==
+
* [[S.japonica_sterols_curated]]
* [[RXN-8988]]
+
== Reaction(s) associated ==
== Reaction(s) of unknown directionality ==
+
* [[DNA-DIRECTED-RNA-POLYMERASE-RXN]]
{{#set: common-name=itaconyl-coa}}
+
** Category: [[annotation]]
{{#set: inchi-key=inchikey=nfvgylgssjprkw-citakdkdsa-i}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: molecular-weight=874.579}}
+
* [[RXN0-5021]]
 +
** Category: [[orthology]]
 +
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=51173}}
 +
{{#set: left-end-position=41872}}
 +
{{#set: centisome-position=21.6281    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=2}}

Revision as of 20:20, 18 December 2020

Gene SJ21402

  • transcription-direction:
    • negative
  • right-end-position:
    • 51173
  • left-end-position:
    • 41872
  • centisome-position:
    • 21.6281

Organism(s) associated with this gene

Reaction(s) associated