Difference between revisions of "SJ08557"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15279 CPD-15279] == * common-name: ** γ-l-glutamyl-s-(hercyn-2-yl)-l-cysteine s-oxide...")
(Created page with "Category:gene == Gene SJ08557 == * transcription-direction: ** positive * right-end-position: ** 68726 * left-end-position: ** 58597 * centisome-position: ** 13.402178...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15279 CPD-15279] ==
+
== Gene SJ08557 ==
−
* common-name:
+
* transcription-direction:
−
** γ-l-glutamyl-s-(hercyn-2-yl)-l-cysteine s-oxide
+
** positive
−
* smiles:
+
* right-end-position:
−
** c[n+](c(c(=o)[o-])cc1(=cnc(s(=o)cc(c([o-])=o)nc(=o)ccc([n+])c(=o)[o-])=n1))(c)c
+
** 68726
−
* inchi-key:
+
* left-end-position:
−
** sjhlsluuwibqns-tylceogasa-m
+
** 58597
−
* molecular-weight:
+
* centisome-position:
−
** 460.481
+
** 13.402178   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
== Reaction(s) known to produce the compound ==
+
* [[S.japonica_carotenoid_curated]]
−
* [[RXN-14430]]
+
== Reaction(s) associated ==
−
== Reaction(s) of unknown directionality ==
+
* [[GCVP-RXN]]
−
{{#set: common-name=γ-l-glutamyl-s-(hercyn-2-yl)-l-cysteine s-oxide}}
+
** Category: [[orthology]]
−
{{#set: inchi-key=inchikey=sjhlsluuwibqns-tylceogasa-m}}
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
−
{{#set: molecular-weight=460.481}}
+
* [[GCVT-RXN]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
** Category: [[orthology]]
 +
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
== Pathway(s) associated ==
 +
* [[GLYCLEAV-PWY]]
 +
** '''3''' reactions found over '''3''' reactions in the full pathway
 +
* [[GLYCINE-SYN2-PWY]]
 +
** '''2''' reactions found over '''3''' reactions in the full pathway
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=68726}}
 +
{{#set: left-end-position=58597}}
 +
{{#set: centisome-position=13.402178    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=2}}
 +
{{#set: nb pathway associated=2}}

Latest revision as of 11:00, 18 March 2021

Gene SJ08557

  • transcription-direction:
    • positive
  • right-end-position:
    • 68726
  • left-end-position:
    • 58597
  • centisome-position:
    • 13.402178

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ08557&oldid=131638"