Difference between revisions of "SJ08770"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IDP IDP] == * common-name: ** idp * smiles: ** c(op(=o)([o-])op([o-])(=o)[o-])c1(oc(c(o)c(o)1)n...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8165 CPD-8165] == * common-name: ** 1-18:2-2-18:2-monogalactosyldiacylglycerol * smiles: **...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IDP IDP] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8165 CPD-8165] ==
 
* common-name:
 
* common-name:
** idp
+
** 1-18:2-2-18:2-monogalactosyldiacylglycerol
 
* smiles:
 
* smiles:
** c(op(=o)([o-])op([o-])(=o)[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23)))
+
** cccccc=ccc=ccccccccc(occ(coc1(oc(co)c(o)c(o)c(o)1))oc(=o)cccccccc=ccc=cccccc)=o
 
* inchi-key:
 
* inchi-key:
** jpxzqmkkfwmmgk-kqynxxcusa-k
+
** broompuvdptgeg-rhnbirjrsa-n
 
* molecular-weight:
 
* molecular-weight:
** 425.165
+
** 779.105
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ADP-DEAMINASE-RXN]]
+
* [[RXN-8366]]
* [[ATID]]
+
* [[RXN-8367]]
* [[ATIDm]]
 
* [[RXN-14003]]
 
* [[RXN-14120]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ADP-DEAMINASE-RXN]]
 
* [[ITCY]]
 
* [[ITUP]]
 
* [[RXN-14120]]
 
* [[RXN0-5073]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=idp}}
+
{{#set: common-name=1-18:2-2-18:2-monogalactosyldiacylglycerol}}
{{#set: inchi-key=inchikey=jpxzqmkkfwmmgk-kqynxxcusa-k}}
+
{{#set: inchi-key=inchikey=broompuvdptgeg-rhnbirjrsa-n}}
{{#set: molecular-weight=425.165}}
+
{{#set: molecular-weight=779.105}}

Revision as of 14:19, 26 August 2019

Metabolite CPD-8165

  • common-name:
    • 1-18:2-2-18:2-monogalactosyldiacylglycerol
  • smiles:
    • cccccc=ccc=ccccccccc(occ(coc1(oc(co)c(o)c(o)c(o)1))oc(=o)cccccccc=ccc=cccccc)=o
  • inchi-key:
    • broompuvdptgeg-rhnbirjrsa-n
  • molecular-weight:
    • 779.105

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality