Difference between revisions of "SJ08770"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8165 CPD-8165] == * common-name: ** 1-18:2-2-18:2-monogalactosyldiacylglycerol * smiles: **...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Glutamine-synthetase-Tyr Glutamine-synthetase-Tyr] == * common-name: ** a [glutamine-synthetase...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8165 CPD-8165] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Glutamine-synthetase-Tyr Glutamine-synthetase-Tyr] ==
 
* common-name:
 
* common-name:
** 1-18:2-2-18:2-monogalactosyldiacylglycerol
+
** a [glutamine-synthetase]-l-tyrosine
* smiles:
 
** cccccc=ccc=ccccccccc(occ(coc1(oc(co)c(o)c(o)c(o)1))oc(=o)cccccccc=ccc=cccccc)=o
 
* inchi-key:
 
** broompuvdptgeg-rhnbirjrsa-n
 
* molecular-weight:
 
** 779.105
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8366]]
+
* [[GSADENYLATION-RXN]]
* [[RXN-8367]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-18:2-2-18:2-monogalactosyldiacylglycerol}}
+
{{#set: common-name=a [glutamine-synthetase]-l-tyrosine}}
{{#set: inchi-key=inchikey=broompuvdptgeg-rhnbirjrsa-n}}
 
{{#set: molecular-weight=779.105}}
 

Revision as of 09:23, 27 August 2019

Metabolite Glutamine-synthetase-Tyr

  • common-name:
    • a [glutamine-synthetase]-l-tyrosine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [glutamine-synthetase]-l-tyrosine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.