Difference between revisions of "SJ08803"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Poly-Hydroxybutyrate Poly-Hydroxybutyrate] == * common-name: ** poly-3-hydroxybutanoate == Reac...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-663 CPD-663] == * common-name: ** udp-4-dehydro-6-deoxy-α-d-glucose * smiles: ** cc3(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Poly-Hydroxybutyrate Poly-Hydroxybutyrate] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-663 CPD-663] ==
 
* common-name:
 
* common-name:
** poly-3-hydroxybutanoate
+
** udp-4-dehydro-6-deoxy-α-d-glucose
 +
* smiles:
 +
** cc3(oc(op(op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))([o-])=o)c(o)c(o)c(=o)3)
 +
* inchi-key:
 +
** ddwgqqadoimfoi-jphisprksa-l
 +
* molecular-weight:
 +
** 546.274
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.1.1.75-RXN]]
+
* [[RXN-18332]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.1.1.75-RXN]]
+
* [[RXN-18332]]
 +
* [[UDP-GLUCOSE-46-DEHYDRATASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=poly-3-hydroxybutanoate}}
+
{{#set: common-name=udp-4-dehydro-6-deoxy-α-d-glucose}}
 +
{{#set: inchi-key=inchikey=ddwgqqadoimfoi-jphisprksa-l}}
 +
{{#set: molecular-weight=546.274}}

Revision as of 14:20, 26 August 2019

Metabolite CPD-663

  • common-name:
    • udp-4-dehydro-6-deoxy-α-d-glucose
  • smiles:
    • cc3(oc(op(op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))([o-])=o)c(o)c(o)c(=o)3)
  • inchi-key:
    • ddwgqqadoimfoi-jphisprksa-l
  • molecular-weight:
    • 546.274

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality