Difference between revisions of "SJ08807"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7117 CPD-7117] == * common-name: ** delphinidin-3-o-β-d-glucoside * smiles: ** c(o)c1(...")
(Created page with "Category:gene == Gene SJ14526 == * transcription-direction: ** negative * right-end-position: ** 362545 * left-end-position: ** 353790 * centisome-position: ** 49.64519...")
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7117 CPD-7117] ==
+
== Gene SJ14526 ==
−
* common-name:
+
* transcription-direction:
−
** delphinidin-3-o-β-d-glucoside
+
** negative
−
* smiles:
+
* right-end-position:
−
** c(o)c1(c(o)c(o)c(o)c(o1)oc3(c(c2(c=c(o)c(o)=c(o)c=2))=[o+]c4(c(c=3)=c([o-])c=c([o-])c=4)))
+
** 362545
−
* inchi-key:
+
* left-end-position:
−
** xenhpqqldpayij-pevlunpasa-m
+
** 353790
−
* molecular-weight:
+
* centisome-position:
−
** 463.374
+
** 49.64519   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[RXN-8228]]
+
* [[S.japonica_sterols_curated]]
−
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
−
== Reaction(s) of unknown directionality ==
+
* [[3.1.4.17-RXN]]
−
{{#set: common-name=delphinidin-3-o-β-d-glucoside}}
+
** Category: [[annotation]]
−
{{#set: inchi-key=inchikey=xenhpqqldpayij-pevlunpasa-m}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
{{#set: molecular-weight=463.374}}
+
** Category: [[orthology]]
 +
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
* [[35-CYCLIC-GMP-PHOSPHODIESTERASE-RXN]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
* [[RXN0-5038]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=362545}}
 +
{{#set: left-end-position=353790}}
 +
{{#set: centisome-position=49.64519    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=3}}

Revision as of 20:21, 18 December 2020

Gene SJ14526

  • transcription-direction:
    • negative
  • right-end-position:
    • 362545
  • left-end-position:
    • 353790
  • centisome-position:
    • 49.64519

Organism(s) associated with this gene

Reaction(s) associated




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ08807&oldid=41767"