Difference between revisions of "SJ08834"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9895 CPD-9895] == * common-name: ** 3,4-dihydroxy-5-all-trans-decaprenylbenzoate * smiles:...")
(Created page with "Category:gene == Gene SJ04468 == * transcription-direction: ** positive * right-end-position: ** 41936 * left-end-position: ** 11345 * centisome-position: ** 10.640493...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9895 CPD-9895] ==
+
== Gene SJ04468 ==
* common-name:
+
* transcription-direction:
** 3,4-dihydroxy-5-all-trans-decaprenylbenzoate
+
** positive
* smiles:
+
* right-end-position:
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(=cc(c([o-])=o)=c1)o)o))c)c)c)c)c)c)c)c)c)c
+
** 41936
* inchi-key:
+
* left-end-position:
** hgwugdiatlopbn-bhzqgfrmsa-m
+
** 11345
* molecular-weight:
+
* centisome-position:
** 834.296
+
** 10.640493   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[RXN-9282]]
+
* [[S.japonica_sterols_curated]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
== Reaction(s) of unknown directionality ==
+
* [[ARYLSULFAT-RXN]]
{{#set: common-name=3,4-dihydroxy-5-all-trans-decaprenylbenzoate}}
+
** Category: [[annotation]]
{{#set: inchi-key=inchikey=hgwugdiatlopbn-bhzqgfrmsa-m}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: molecular-weight=834.296}}
+
** Category: [[orthology]]
 +
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=41936}}
 +
{{#set: left-end-position=11345}}
 +
{{#set: centisome-position=10.640493    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=1}}

Revision as of 20:20, 18 December 2020

Gene SJ04468

  • transcription-direction:
    • positive
  • right-end-position:
    • 41936
  • left-end-position:
    • 11345
  • centisome-position:
    • 10.640493

Organism(s) associated with this gene

Reaction(s) associated