Difference between revisions of "SJ08875"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Poly-beta-D-Mannuronate Poly-beta-D-Mannuronate] == * common-name: ** mannuronan == Reaction(s)...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9859 CPD-9859] == * common-name: ** 6-methoxy-3-methyl-2-all-trans-heptaprenyl-1,4-benzoqui...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9859 CPD-9859] == |
* common-name: | * common-name: | ||
− | ** | + | ** 6-methoxy-3-methyl-2-all-trans-heptaprenyl-1,4-benzoquinol |
+ | * smiles: | ||
+ | ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(=c1c)o)o))c)c)c)c)c)c | ||
+ | * inchi-key: | ||
+ | ** rohkdmwqxdhldy-hohoqcmasa-n | ||
+ | * molecular-weight: | ||
+ | ** 630.993 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-9227]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=6-methoxy-3-methyl-2-all-trans-heptaprenyl-1,4-benzoquinol}} |
+ | {{#set: inchi-key=inchikey=rohkdmwqxdhldy-hohoqcmasa-n}} | ||
+ | {{#set: molecular-weight=630.993}} |
Revision as of 14:20, 26 August 2019
Contents
Metabolite CPD-9859
- common-name:
- 6-methoxy-3-methyl-2-all-trans-heptaprenyl-1,4-benzoquinol
- smiles:
- cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(=c1c)o)o))c)c)c)c)c)c
- inchi-key:
- rohkdmwqxdhldy-hohoqcmasa-n
- molecular-weight:
- 630.993