Difference between revisions of "SJ08994"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Thiopurines Thiopurines] == * common-name: ** a thiopurine == Reaction(s) known to consume the...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUCONATE GLUCONATE] == * common-name: ** d-gluconate * smiles: ** c(o)c(o)c(o)c(o)c(o)c(=o)[o-...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUCONATE GLUCONATE] == |
* common-name: | * common-name: | ||
| − | ** | + | ** d-gluconate |
| + | * smiles: | ||
| + | ** c(o)c(o)c(o)c(o)c(o)c(=o)[o-] | ||
| + | * inchi-key: | ||
| + | ** rghnjxzeokukbd-sqougzdysa-m | ||
| + | * molecular-weight: | ||
| + | ** 195.149 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[GLUCONOKIN-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[GLUCONATE-5-DEHYDROGENASE-RXN]] | ||
| + | * [[GLUCONOLACT-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=d-gluconate}} |
| + | {{#set: inchi-key=inchikey=rghnjxzeokukbd-sqougzdysa-m}} | ||
| + | {{#set: molecular-weight=195.149}} | ||
Revision as of 09:24, 27 August 2019
Contents
Metabolite GLUCONATE
- common-name:
- d-gluconate
- smiles:
- c(o)c(o)c(o)c(o)c(o)c(=o)[o-]
- inchi-key:
- rghnjxzeokukbd-sqougzdysa-m
- molecular-weight:
- 195.149
