Difference between revisions of "SJ09000"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11410 CPD-11410] == * common-name: ** triiodothyroacetate ether glucuronide * smiles: ** c(...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Polynucleotide-Holder Polynucleotide-Holder] == * common-name: ** a generic polynucleotide subs...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11410 CPD-11410] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Polynucleotide-Holder Polynucleotide-Holder] ==
 
* common-name:
 
* common-name:
** triiodothyroacetate ether glucuronide
+
** a generic polynucleotide substrate
* smiles:
 
** c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc3(=cc(i)=c(oc2(oc(c([o-])=o)c(o)c(o)c(o)2))c=c3))
 
* inchi-key:
 
** vxvbzmwowmhxtq-kfyubchvsa-l
 
* molecular-weight:
 
** 796.046
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[3.1.31.1-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10619]]
+
* [[POLYNUCLEOTIDE-3-PHOSPHATASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=triiodothyroacetate ether glucuronide}}
+
{{#set: common-name=a generic polynucleotide substrate}}
{{#set: inchi-key=inchikey=vxvbzmwowmhxtq-kfyubchvsa-l}}
 
{{#set: molecular-weight=796.046}}
 

Revision as of 14:20, 26 August 2019

Metabolite Polynucleotide-Holder

  • common-name:
    • a generic polynucleotide substrate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality