Difference between revisions of "SJ09069"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUCONATE GLUCONATE] == * common-name: ** d-gluconate * smiles: ** c(o)c(o)c(o)c(o)c(o)c(=o)[o-...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Delta4-hexadecenoyl-ACPs Delta4-hexadecenoyl-ACPs] == * common-name: ** a (4z)-hexadec-4-enoyl-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUCONATE GLUCONATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Delta4-hexadecenoyl-ACPs Delta4-hexadecenoyl-ACPs] ==
 
* common-name:
 
* common-name:
** d-gluconate
+
** a (4z)-hexadec-4-enoyl-[acp]
* smiles:
 
** c(o)c(o)c(o)c(o)c(o)c(=o)[o-]
 
* inchi-key:
 
** rghnjxzeokukbd-sqougzdysa-m
 
* molecular-weight:
 
** 195.149
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[GLUCONOKIN-RXN]]
+
* [[RXN-8391]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GLUCONATE-5-DEHYDROGENASE-RXN]]
 
* [[GLUCONOLACT-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-gluconate}}
+
{{#set: common-name=a (4z)-hexadec-4-enoyl-[acp]}}
{{#set: inchi-key=inchikey=rghnjxzeokukbd-sqougzdysa-m}}
 
{{#set: molecular-weight=195.149}}
 

Revision as of 09:24, 27 August 2019

Metabolite Delta4-hexadecenoyl-ACPs

  • common-name:
    • a (4z)-hexadec-4-enoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a (4z)-hexadec-4-enoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.