Difference between revisions of "SJ09127"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Linoleoyl-groups Linoleoyl-groups] == * common-name: ** a [glycerolipid]-linoleate == Reaction(...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3187 CPD-3187] == * common-name: ** 2'-hydroxynicotine * smiles: ** c1(ccc(o)([n+](c)1)c2(=...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3187 CPD-3187] == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2'-hydroxynicotine |
| + | * smiles: | ||
| + | ** c1(ccc(o)([n+](c)1)c2(=cn=cc=c2)) | ||
| + | * inchi-key: | ||
| + | ** boqrppfuushfgw-snvbaglbsa-o | ||
| + | * molecular-weight: | ||
| + | ** 179.241 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN66-146]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2'-hydroxynicotine}} |
| + | {{#set: inchi-key=inchikey=boqrppfuushfgw-snvbaglbsa-o}} | ||
| + | {{#set: molecular-weight=179.241}} | ||
Revision as of 09:23, 27 August 2019
Contents
Metabolite CPD-3187
- common-name:
- 2'-hydroxynicotine
- smiles:
- c1(ccc(o)([n+](c)1)c2(=cn=cc=c2))
- inchi-key:
- boqrppfuushfgw-snvbaglbsa-o
- molecular-weight:
- 179.241
