Difference between revisions of "SJ09229"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FRU1P FRU1P] == * common-name: ** β-d-fructofuranose 1-phosphate * smiles: ** c(o)c1(c(o)c...")
 
(Created page with "Category:gene == Gene SJ09229 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * MALTODEXGLUCOSID-RXN *...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FRU1P FRU1P] ==
+
== Gene SJ09229 ==
* common-name:
+
== Organism(s) associated with this gene  ==
** β-d-fructofuranose 1-phosphate
+
* [[S.japonica_carotenoid_curated]]
* smiles:
+
== Reaction(s) associated ==
** c(o)c1(c(o)c(o)c(cop([o-])([o-])=o)(o)o1)
+
* [[MALTODEXGLUCOSID-RXN]]
* inchi-key:
+
** Category: [[orthology]]
** rhkkzbwrnhgjez-arqdhwqxsa-l
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
* molecular-weight:
+
* [[RXN-14281]]
** 258.121
+
** Category: [[orthology]]
== Reaction(s) known to consume the compound ==
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
* [[RXN-8631]]
+
* [[RXN-14282]]
== Reaction(s) known to produce the compound ==
+
** Category: [[orthology]]
== Reaction(s) of unknown directionality ==
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
{{#set: common-name=β-d-fructofuranose 1-phosphate}}
+
* [[RXN-14283]]
{{#set: inchi-key=inchikey=rhkkzbwrnhgjez-arqdhwqxsa-l}}
+
** Category: [[orthology]]
{{#set: molecular-weight=258.121}}
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
* [[RXN-15910]]
 +
** Category: [[orthology]]
 +
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
* [[RXN0-5183]]
 +
** Category: [[orthology]]
 +
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
== Pathway(s) associated ==
 +
* [[PWY-842]]
 +
** '''1''' reactions found over '''3''' reactions in the full pathway
 +
* [[GLYCOCAT-PWY]]
 +
** '''6''' reactions found over '''8''' reactions in the full pathway
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=6}}
 +
{{#set: nb pathway associated=2}}

Latest revision as of 11:02, 18 March 2021

Gene SJ09229

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-842
    • 1 reactions found over 3 reactions in the full pathway
  • GLYCOCAT-PWY
    • 6 reactions found over 8 reactions in the full pathway