Difference between revisions of "SJ09229"

Revision as of 14:19, 26 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FRU1P FRU1P] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CARNITINE CARNITINE] ==
 * common-name:
-** &beta;-d-fructofuranose 1-phosphate
+** l-carnitine
 * smiles:
-** c(o)c1(c(o)c(o)c(cop([o-])([o-])=o)(o)o1)
+** c(c(o)cc(=o)[o-])[n+](c)(c)c
 * inchi-key:
-** rhkkzbwrnhgjez-arqdhwqxsa-l
+** phiqhxfuzvpyii-zcfiwibfsa-n
 * molecular-weight:
-** 258.121
+** 161.2
 == Reaction(s) known to consume the compound ==
-* [[RXN-8631]]
+* [[CARNITINE-O-ACETYLTRANSFERASE-RXN]]
+* [[CARNITINE-O-PALMITOYLTRANSFERASE-RXN]]
+* [[RXN-9918]]
 == Reaction(s) known to produce the compound ==
+* [[1.14.11.1-RXN]]
+* [[CARNITINE-O-ACETYLTRANSFERASE-RXN]]
+* [[CARNITINE-O-PALMITOYLTRANSFERASE-RXN]]
+* [[RXN-9918]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=&beta;-d-fructofuranose 1-phosphate}}
+{{#set: common-name=l-carnitine}}
-{{#set: inchi-key=inchikey=rhkkzbwrnhgjez-arqdhwqxsa-l}}
+{{#set: inchi-key=inchikey=phiqhxfuzvpyii-zcfiwibfsa-n}}
-{{#set: molecular-weight=258.121}}
+{{#set: molecular-weight=161.2}}