Difference between revisions of "SJ09236"

Revision as of 09:23, 27 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-METHYL-ACETO-ACETYL-COA 2-METHYL-ACETO-ACETYL-COA] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Semiquinones Semiquinones] ==
 * common-name:
-** 2-methylacetoacetyl-coa
+** a semiquinone
-* smiles:
-** cc(c(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)c(=o)c
-* inchi-key:
-** nhnodhrscralbf-nqnbqjknsa-j
-* molecular-weight:
-** 861.604
 == Reaction(s) known to consume the compound ==
-* [[1.1.1.178-RXN]]
-* [[ACCAT]]
-* [[HMNOS]]
-* [[METHYLACETOACETYLCOATHIOL-RXN]]
 == Reaction(s) known to produce the compound ==
-* [[1.1.1.178-RXN]]
+* [[QOR-RXN]]
-* [[HMNOS]]
-* [[METHYLACETOACETYLCOATHIOL-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=2-methylacetoacetyl-coa}}
+{{#set: common-name=a semiquinone}}
-{{#set: inchi-key=inchikey=nhnodhrscralbf-nqnbqjknsa-j}}
-{{#set: molecular-weight=861.604}}