Difference between revisions of "SJ09372"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MANNITOL-1P MANNITOL-1P] == * common-name: ** d-mannitol 1-phosphate * smiles: ** c(c(c(c(c(cop...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-1-LYSOPHOSPHATIDATE L-1-LYSOPHOSPHATIDATE] == * common-name: ** 1-oleyl-2-lyso-phosphatidate...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-1-LYSOPHOSPHATIDATE L-1-LYSOPHOSPHATIDATE] == |
* common-name: | * common-name: | ||
− | ** | + | ** 1-oleyl-2-lyso-phosphatidate |
* smiles: | * smiles: | ||
− | ** | + | ** ccccccccc=ccccccccc(=o)occ(cop([o-])([o-])=o)o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** wrgqswvcfniunz-gdckjwnlsa-l |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 434.509 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-15043]] |
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-15045]] |
+ | * [[RXN-15068]] | ||
+ | * [[RXN-15091]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=1-oleyl-2-lyso-phosphatidate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=wrgqswvcfniunz-gdckjwnlsa-l}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=434.509}} |
Revision as of 14:20, 26 August 2019
Contents
Metabolite L-1-LYSOPHOSPHATIDATE
- common-name:
- 1-oleyl-2-lyso-phosphatidate
- smiles:
- ccccccccc=ccccccccc(=o)occ(cop([o-])([o-])=o)o
- inchi-key:
- wrgqswvcfniunz-gdckjwnlsa-l
- molecular-weight:
- 434.509