Difference between revisions of "SJ09372"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-1-LYSOPHOSPHATIDATE L-1-LYSOPHOSPHATIDATE] == * common-name: ** 1-oleyl-2-lyso-phosphatidate...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-Glutaminyl-Peptides L-Glutaminyl-Peptides] == * common-name: ** an n-terminal l-glutaminyl-[p...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-1-LYSOPHOSPHATIDATE L-1-LYSOPHOSPHATIDATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-Glutaminyl-Peptides L-Glutaminyl-Peptides] ==
 
* common-name:
 
* common-name:
** 1-oleyl-2-lyso-phosphatidate
+
** an n-terminal l-glutaminyl-[protein]
* smiles:
 
** ccccccccc=ccccccccc(=o)occ(cop([o-])([o-])=o)o
 
* inchi-key:
 
** wrgqswvcfniunz-gdckjwnlsa-l
 
* molecular-weight:
 
** 434.509
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-15043]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15045]]
+
* [[RXN-17893]]
* [[RXN-15068]]
 
* [[RXN-15091]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-oleyl-2-lyso-phosphatidate}}
+
{{#set: common-name=an n-terminal l-glutaminyl-[protein]}}
{{#set: inchi-key=inchikey=wrgqswvcfniunz-gdckjwnlsa-l}}
 
{{#set: molecular-weight=434.509}}
 

Revision as of 09:24, 27 August 2019

Metabolite L-Glutaminyl-Peptides

  • common-name:
    • an n-terminal l-glutaminyl-[protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an n-terminal l-glutaminyl-[protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.