Difference between revisions of "SJ09376"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18 CPD-18] == * common-name: ** linoleoyl-coa * smiles: ** cccccc=ccc=ccccccccc(=o)sccnc(=o...")
(Created page with "Category:gene == Gene SJ09376 == * transcription-direction: ** negative * right-end-position: ** 551075 * left-end-position: ** 542795 * centisome-position: ** 66.14152...")
 
(7 intermediate revisions by 2 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18 CPD-18] ==
+
== Gene SJ09376 ==
* common-name:
+
* transcription-direction:
** linoleoyl-coa
+
** negative
* smiles:
+
* right-end-position:
** cccccc=ccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** 551075
* inchi-key:
+
* left-end-position:
** yecllimzhnyfck-rrnjgntnsa-j
+
** 542795
* molecular-weight:
+
* centisome-position:
** 1025.937
+
** 66.14152   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[1.14.19.3-RXN]]
+
* [[S.japonica_carotenoid_curated]]
* [[FACOAE182]]
+
== Reaction(s) associated ==
* [[LINOLEOYL-RXN]]
+
* [[PEPTIDE-ASPARTATE-BETA-DIOXYGENASE-RXN]]
* [[RXN-16094]]
+
** Category: [[annotation]]
== Reaction(s) known to produce the compound ==
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[LNLCCOAL]]
+
** Category: [[orthology]]
* [[RXN-16045]]
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
* [[RXN-9601]]
+
{{#set: transcription-direction=negative}}
* [[RXN-9673]]
+
{{#set: right-end-position=551075}}
== Reaction(s) of unknown directionality ==
+
{{#set: left-end-position=542795}}
{{#set: common-name=linoleoyl-coa}}
+
{{#set: centisome-position=66.14152    }}
{{#set: inchi-key=inchikey=yecllimzhnyfck-rrnjgntnsa-j}}
+
{{#set: organism associated=S.japonica_carotenoid_curated}}
{{#set: molecular-weight=1025.937}}
+
{{#set: nb reaction associated=1}}

Latest revision as of 11:01, 18 March 2021

Gene SJ09376

  • transcription-direction:
    • negative
  • right-end-position:
    • 551075
  • left-end-position:
    • 542795
  • centisome-position:
    • 66.14152

Organism(s) associated with this gene

Reaction(s) associated