Difference between revisions of "SJ09392"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-uridine-38-40 tRNA-uridine-38-40] == * common-name: ** a uridine38-40 in trna == Reaction(...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-37 CPDQT-37] == * common-name: ** 3-[(4'-methylthio)butyl]malate * smiles: ** csccccc(c(o...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-37 CPDQT-37] == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-[(4'-methylthio)butyl]malate |
| + | * smiles: | ||
| + | ** csccccc(c(o)c(=o)[o-])c(=o)[o-] | ||
| + | * inchi-key: | ||
| + | ** zizldvklmyvmnx-uhfffaoysa-l | ||
| + | * molecular-weight: | ||
| + | ** 234.267 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-18206]] |
| + | * [[RXNQT-4168]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-18206]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-[(4'-methylthio)butyl]malate}} |
| + | {{#set: inchi-key=inchikey=zizldvklmyvmnx-uhfffaoysa-l}} | ||
| + | {{#set: molecular-weight=234.267}} | ||
Revision as of 09:25, 27 August 2019
Contents
Metabolite CPDQT-37
- common-name:
- 3-[(4'-methylthio)butyl]malate
- smiles:
- csccccc(c(o)c(=o)[o-])c(=o)[o-]
- inchi-key:
- zizldvklmyvmnx-uhfffaoysa-l
- molecular-weight:
- 234.267
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "3-[(4'-methylthio)butyl]malate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
