Difference between revisions of "SJ09409"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXYGUANOSINE DEOXYGUANOSINE] == * common-name: ** 2'-deoxyguanosine * smiles: ** c(o)c1(oc(cc...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8490 CPD-8490] == * common-name: ** decanal * smiles: ** ccccccccc[ch]=o * inchi-key: ** ks...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXYGUANOSINE DEOXYGUANOSINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8490 CPD-8490] ==
 
* common-name:
 
* common-name:
** 2'-deoxyguanosine
+
** decanal
 
* smiles:
 
* smiles:
** c(o)c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
+
** ccccccccc[ch]=o
 
* inchi-key:
 
* inchi-key:
** ykbgvtzyehremt-kvqbguixsa-n
+
** ksmvzqyavgtkiv-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 267.244
+
** 156.267
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DEOXYGUANPHOSPHOR-RXN]]
+
* [[RXN-16653]]
* [[DMPH]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DEOXYGUANPHOSPHOR-RXN]]
 
* [[DGTPTRIPHYDRO-RXN]]
 
* [[DMPH]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2'-deoxyguanosine}}
+
{{#set: common-name=decanal}}
{{#set: inchi-key=inchikey=ykbgvtzyehremt-kvqbguixsa-n}}
+
{{#set: inchi-key=inchikey=ksmvzqyavgtkiv-uhfffaoysa-n}}
{{#set: molecular-weight=267.244}}
+
{{#set: molecular-weight=156.267}}

Revision as of 14:20, 26 August 2019

Metabolite CPD-8490

  • common-name:
    • decanal
  • smiles:
    • ccccccccc[ch]=o
  • inchi-key:
    • ksmvzqyavgtkiv-uhfffaoysa-n
  • molecular-weight:
    • 156.267

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality