Difference between revisions of "SJ09422"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GDP-TP GDP-TP] == * common-name: ** pppgpp * smiles: ** c(op([o-])(=o)op([o-])(=o)op([o-])(=o)[...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Histone-Acetyl-Lysine Histone-Acetyl-Lysine] == * common-name: ** a [histone]-n6-acetyl-l-lysin...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GDP-TP GDP-TP] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Histone-Acetyl-Lysine Histone-Acetyl-Lysine] ==
 
* common-name:
 
* common-name:
** pppgpp
+
** a [histone]-n6-acetyl-l-lysine
* smiles:
 
** c(op([o-])(=o)op([o-])(=o)op([o-])(=o)[o-])c1(oc(c(o)c(op([o-])(=o)op(o)([o-])=o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
 
* inchi-key:
 
** kcpmacxzaitqax-uuokfmhzsa-h
 
* molecular-weight:
 
** 677.095
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-6427]]
+
* [[3.5.1.98-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GTPPYPHOSKIN-RXN]]
+
* [[HISTONE-ACETYLTRANSFERASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=pppgpp}}
+
{{#set: common-name=a [histone]-n6-acetyl-l-lysine}}
{{#set: inchi-key=inchikey=kcpmacxzaitqax-uuokfmhzsa-h}}
 
{{#set: molecular-weight=677.095}}
 

Revision as of 14:20, 26 August 2019

Metabolite Histone-Acetyl-Lysine

  • common-name:
    • a [histone]-n6-acetyl-l-lysine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [histone]-n6-acetyl-l-lysine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.