Difference between revisions of "SJ09519"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12258 CPD-12258] == * common-name: ** udp-n-acetyl-α-d-muramoyl-l-alanyl-γ-d-gl...")
(Created page with "Category:gene == Gene SJ09519 == * transcription-direction: ** positive * right-end-position: ** 33191 * left-end-position: ** 31737 * centisome-position: ** 79.24147...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12258 CPD-12258] ==
+
== Gene SJ09519 ==
* common-name:
+
* transcription-direction:
** udp-n-acetyl-α-d-muramoyl-l-alanyl-γ-d-glutamyl-l-lysyl-d-alanine
+
** positive
* smiles:
+
* right-end-position:
** cc(c(=o)nc(c(=o)[o-])ccc(=o)nc(cccc[n+])c(nc(c)c(=o)[o-])=o)nc(=o)c(c)oc1(c(o)c(co)oc(c(nc(=o)c)1)op(op(occ2(oc(c(o)c(o)2)n3(c=cc(=o)nc(=o)3)))([o-])=o)([o-])=o)
+
** 33191
* inchi-key:
+
* left-end-position:
** foedsvrzgqixsp-xsoiktqosa-k
+
** 31737
* molecular-weight:
+
* centisome-position:
** 1075.843
+
** 79.24147   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[RXN-11347]]
+
* [[S.japonica_carotenoid_curated]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
== Reaction(s) of unknown directionality ==
+
* [[RNA-DIRECTED-DNA-POLYMERASE-RXN]]
{{#set: common-name=udp-n-acetyl-α-d-muramoyl-l-alanyl-γ-d-glutamyl-l-lysyl-d-alanine}}
+
** Category: [[annotation]]
{{#set: inchi-key=inchikey=foedsvrzgqixsp-xsoiktqosa-k}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: molecular-weight=1075.843}}
+
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=33191}}
 +
{{#set: left-end-position=31737}}
 +
{{#set: centisome-position=79.24147    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=1}}

Latest revision as of 11:00, 18 March 2021

Gene SJ09519

  • transcription-direction:
    • positive
  • right-end-position:
    • 33191
  • left-end-position:
    • 31737
  • centisome-position:
    • 79.24147

Organism(s) associated with this gene

Reaction(s) associated