Difference between revisions of "SJ09520"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Oligomers-Of-Galactosamines Oligomers-Of-Galactosamines] == * common-name: ** an oligomer of ga...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17387 CPD-17387] == * common-name: ** (3s)-hydroxy-(6z,9z,12z,15z,18z,21z)-tetracosahexaeno...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17387 CPD-17387] == |
* common-name: | * common-name: | ||
− | ** | + | ** (3s)-hydroxy-(6z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa |
+ | * smiles: | ||
+ | ** ccc=ccc=ccc=ccc=ccc=ccc=cccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o | ||
+ | * inchi-key: | ||
+ | ** jjcguwrdulvwqg-drxnpijbsa-j | ||
+ | * molecular-weight: | ||
+ | ** 1118.034 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-16135]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=(3s)-hydroxy-(6z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa}} |
+ | {{#set: inchi-key=inchikey=jjcguwrdulvwqg-drxnpijbsa-j}} | ||
+ | {{#set: molecular-weight=1118.034}} |
Revision as of 14:20, 26 August 2019
Contents
Metabolite CPD-17387
- common-name:
- (3s)-hydroxy-(6z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa
- smiles:
- ccc=ccc=ccc=ccc=ccc=ccc=cccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
- inchi-key:
- jjcguwrdulvwqg-drxnpijbsa-j
- molecular-weight:
- 1118.034