Difference between revisions of "SJ09520"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17387 CPD-17387] == * common-name: ** (3s)-hydroxy-(6z,9z,12z,15z,18z,21z)-tetracosahexaeno...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1027 CPD0-1027] == * common-name: ** a debranched α-limit dextrin == Reaction(s) kno...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17387 CPD-17387] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1027 CPD0-1027] ==
 
* common-name:
 
* common-name:
−
** (3s)-hydroxy-(6z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa
+
** a debranched α-limit dextrin
−
* smiles:
 
−
** ccc=ccc=ccc=ccc=ccc=ccc=cccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 
−
* inchi-key:
 
−
** jjcguwrdulvwqg-drxnpijbsa-j
 
−
* molecular-weight:
 
−
** 1118.034
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-9025]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-16135]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=(3s)-hydroxy-(6z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa}}
+
{{#set: common-name=a debranched α-limit dextrin}}
−
{{#set: inchi-key=inchikey=jjcguwrdulvwqg-drxnpijbsa-j}}
 
−
{{#set: molecular-weight=1118.034}}
 

Revision as of 09:25, 27 August 2019

Metabolite CPD0-1027

  • common-name:
    • a debranched α-limit dextrin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ09520&oldid=29269"