Difference between revisions of "SJ09623"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Detyrosinated-alpha--tubulins Detyrosinated-alpha--tubulins] == * common-name: ** detyrosinated...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8079 CPD-8079] == * common-name: ** 1-18:1-2-16:3-monogalactosyldiacylglycerol * smiles: **...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Detyrosinated-alpha--tubulins Detyrosinated-alpha--tubulins] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8079 CPD-8079] ==
 
* common-name:
 
* common-name:
** detyrosinated α-tubulin
+
** 1-18:1-2-16:3-monogalactosyldiacylglycerol
 +
* smiles:
 +
** ccccccccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccc=ccc=ccc)=o)=o
 +
* inchi-key:
 +
** uledcqdcqahgfd-lukloydesa-n
 +
* molecular-weight:
 +
** 751.052
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[6.3.2.25-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-8303]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=detyrosinated α-tubulin}}
+
{{#set: common-name=1-18:1-2-16:3-monogalactosyldiacylglycerol}}
 +
{{#set: inchi-key=inchikey=uledcqdcqahgfd-lukloydesa-n}}
 +
{{#set: molecular-weight=751.052}}

Revision as of 14:20, 26 August 2019

Metabolite CPD-8079

  • common-name:
    • 1-18:1-2-16:3-monogalactosyldiacylglycerol
  • smiles:
    • ccccccccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccc=ccc=ccc)=o)=o
  • inchi-key:
    • uledcqdcqahgfd-lukloydesa-n
  • molecular-weight:
    • 751.052

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality