Difference between revisions of "SJ09625"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OROTATE OROTATE] == * common-name: ** orotate * smiles: ** c1(=c(c([o-])=o)nc(nc(=o)1)=o) * inc...")
 
(Created page with "Category:gene == Gene SJ09625 == * transcription-direction: ** negative * right-end-position: ** 32474 * left-end-position: ** 31878 * centisome-position: ** 82.48933...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OROTATE OROTATE] ==
+
== Gene SJ09625 ==
−
* common-name:
+
* transcription-direction:
−
** orotate
+
** negative
−
* smiles:
+
* right-end-position:
−
** c1(=c(c([o-])=o)nc(nc(=o)1)=o)
+
** 32474
−
* inchi-key:
+
* left-end-position:
−
** pxqpewdeaktcgb-uhfffaoysa-m
+
** 31878
−
* molecular-weight:
+
* centisome-position:
−
** 155.09
+
** 82.48933   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[OROPRIBTRANS-RXN]]
+
* [[S.japonica_carotenoid_curated]]
−
* [[ORPRT]]
+
== Reaction(s) associated ==
−
== Reaction(s) known to produce the compound ==
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
−
* [[DIHYDROOROTATE-DEHYDROGENASE-RXN]]
+
* [[3.1.1.64-RXN]]
−
* [[OROPRIBTRANS-RXN]]
+
** Category: [[annotation]]
−
* [[ORPRT]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[RXN0-6491]]
+
* [[CARBOXYLESTERASE-RXN]]
−
* [[RXN0-6554]]
+
** Category: [[annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
{{#set: common-name=orotate}}
+
* [[RETINYL-PALMITATE-ESTERASE-RXN]]
−
{{#set: inchi-key=inchikey=pxqpewdeaktcgb-uhfffaoysa-m}}
+
** Category: [[annotation]]
−
{{#set: molecular-weight=155.09}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
* [[RXN-10711]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
* [[RXN-10767]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
* [[RXN-12252]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
* [[RXN-12575]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
* [[RXNQT-4366]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
</div>
 +
== Pathway(s) associated ==
 +
* [[PWY-6303]]
 +
** '''1''' reactions found over '''2''' reactions in the full pathway
 +
* [[PWY-6857]]
 +
** '''3''' reactions found over '''7''' reactions in the full pathway
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=32474}}
 +
{{#set: left-end-position=31878}}
 +
{{#set: centisome-position=82.48933    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=8}}
 +
{{#set: nb pathway associated=2}}

Latest revision as of 11:02, 18 March 2021

Gene SJ09625

  • transcription-direction:
    • negative
  • right-end-position:
    • 32474
  • left-end-position:
    • 31878
  • centisome-position:
    • 82.48933

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-6303
    • 1 reactions found over 2 reactions in the full pathway
  • PWY-6857
    • 3 reactions found over 7 reactions in the full pathway




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ09625&oldid=132644"