Difference between revisions of "SJ09625"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OROTATE OROTATE] == * common-name: ** orotate * smiles: ** c1(=c(c([o-])=o)nc(nc(=o)1)=o) * inc...") |
(Created page with "Category:gene == Gene SJ09625 == * transcription-direction: ** negative * right-end-position: ** 32474 * left-end-position: ** 31878 * centisome-position: ** 82.48933...") |
||
(9 intermediate revisions by 5 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:gene]] |
− | == | + | == Gene SJ09625 == |
− | * | + | * transcription-direction: |
− | ** | + | ** negative |
− | * | + | * right-end-position: |
− | ** | + | ** 32474 |
− | * | + | * left-end-position: |
− | ** | + | ** 31878 |
− | * | + | * centisome-position: |
− | ** | + | ** 82.48933 |
− | == Reaction(s) | + | == Organism(s) associated with this gene == |
− | * [[ | + | * [[S.japonica_carotenoid_curated]] |
− | * [[ | + | == Reaction(s) associated == |
− | + | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;"> | |
− | * [[ | + | * [[3.1.1.64-RXN]] |
− | * [[ | + | ** Category: [[annotation]] |
− | * [[ | + | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a |
− | * [[ | + | * [[CARBOXYLESTERASE-RXN]] |
− | * [[ | + | ** Category: [[annotation]] |
− | == | + | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a |
− | {{#set: | + | * [[RETINYL-PALMITATE-ESTERASE-RXN]] |
− | {{#set: | + | ** Category: [[annotation]] |
− | {{#set: | + | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a |
+ | * [[RXN-10711]] | ||
+ | ** Category: [[annotation]] | ||
+ | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | ||
+ | * [[RXN-10767]] | ||
+ | ** Category: [[annotation]] | ||
+ | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | ||
+ | * [[RXN-12252]] | ||
+ | ** Category: [[annotation]] | ||
+ | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | ||
+ | * [[RXN-12575]] | ||
+ | ** Category: [[annotation]] | ||
+ | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | ||
+ | * [[RXNQT-4366]] | ||
+ | ** Category: [[annotation]] | ||
+ | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | ||
+ | </div> | ||
+ | == Pathway(s) associated == | ||
+ | * [[PWY-6303]] | ||
+ | ** '''1''' reactions found over '''2''' reactions in the full pathway | ||
+ | * [[PWY-6857]] | ||
+ | ** '''3''' reactions found over '''7''' reactions in the full pathway | ||
+ | {{#set: transcription-direction=negative}} | ||
+ | {{#set: right-end-position=32474}} | ||
+ | {{#set: left-end-position=31878}} | ||
+ | {{#set: centisome-position=82.48933 }} | ||
+ | {{#set: organism associated=S.japonica_carotenoid_curated}} | ||
+ | {{#set: nb reaction associated=8}} | ||
+ | {{#set: nb pathway associated=2}} |
Latest revision as of 11:02, 18 March 2021
Contents
Gene SJ09625
- transcription-direction:
- negative
- right-end-position:
- 32474
- left-end-position:
- 31878
- centisome-position:
- 82.48933
Organism(s) associated with this gene
Reaction(s) associated
- 3.1.1.64-RXN
- Category: annotation
- source: saccharina_japonica_genome; tool: pathwaytools; comment: n.a
- Category: annotation
- CARBOXYLESTERASE-RXN
- Category: annotation
- source: saccharina_japonica_genome; tool: pathwaytools; comment: n.a
- Category: annotation
- RETINYL-PALMITATE-ESTERASE-RXN
- Category: annotation
- source: saccharina_japonica_genome; tool: pathwaytools; comment: n.a
- Category: annotation
- RXN-10711
- Category: annotation
- source: saccharina_japonica_genome; tool: pathwaytools; comment: n.a
- Category: annotation
- RXN-10767
- Category: annotation
- source: saccharina_japonica_genome; tool: pathwaytools; comment: n.a
- Category: annotation
- RXN-12252
- Category: annotation
- source: saccharina_japonica_genome; tool: pathwaytools; comment: n.a
- Category: annotation
- RXN-12575
- Category: annotation
- source: saccharina_japonica_genome; tool: pathwaytools; comment: n.a
- Category: annotation
- RXNQT-4366
- Category: annotation
- source: saccharina_japonica_genome; tool: pathwaytools; comment: n.a
- Category: annotation
Pathway(s) associated
- PWY-6303
- 1 reactions found over 2 reactions in the full pathway
- PWY-6857
- 3 reactions found over 7 reactions in the full pathway