Difference between revisions of "SJ09652"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYTIDINE CYTIDINE] == * common-name: ** cytidine * smiles: ** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2...")
(Created page with "Category:gene == Gene SJ09652 == * transcription-direction: ** positive * right-end-position: ** 6184 * left-end-position: ** 5570 * centisome-position: ** 14.653267 =...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYTIDINE CYTIDINE] ==
+
== Gene SJ09652 ==
* common-name:
+
* transcription-direction:
** cytidine
+
** positive
* smiles:
+
* right-end-position:
** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))o
+
** 6184
* inchi-key:
+
* left-end-position:
** uhdgcwiwmrvcdj-xvfcmesisa-n
+
** 5570
* molecular-weight:
+
* centisome-position:
** 243.219
+
** 14.653267   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[ATCY]]
+
* [[S.japonica_carotenoid_curated]]
* [[ATDTD]]
+
== Reaction(s) associated ==
* [[ATDTDm]]
+
* [[RNA-DIRECTED-DNA-POLYMERASE-RXN]]
* [[CYTIDEAM2-RXN]]
+
** Category: [[annotation]]
* [[DATCY]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[DCTCP]]
+
{{#set: transcription-direction=positive}}
* [[DGTCY]]
+
{{#set: right-end-position=6184}}
* [[DTTGY]]
+
{{#set: left-end-position=5570}}
* [[DTTPtm]]
+
{{#set: centisome-position=14.653267    }}
* [[DUTCP]]
+
{{#set: organism associated=S.japonica_carotenoid_curated}}
* [[GTCY]]
+
{{#set: nb reaction associated=1}}
* [[ITCY]]
 
* [[RXN0-361]]
 
* [[UTCY]]
 
== Reaction(s) known to produce the compound ==
 
* [[ATDTM]]
 
* [[DTTGY]]
 
* [[DTTPtm]]
 
* [[DTTUP]]
 
* [[RXN-14026]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=cytidine}}
 
{{#set: inchi-key=inchikey=uhdgcwiwmrvcdj-xvfcmesisa-n}}
 
{{#set: molecular-weight=243.219}}
 

Latest revision as of 11:01, 18 March 2021

Gene SJ09652

  • transcription-direction:
    • positive
  • right-end-position:
    • 6184
  • left-end-position:
    • 5570
  • centisome-position:
    • 14.653267

Organism(s) associated with this gene

Reaction(s) associated