Difference between revisions of "SJ09656"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-39 CPDQT-39] == * common-name: ** 3-[(6'-methylthio)hexyl]malate * smiles: ** csccccccc(c...")
(Created page with "Category:gene == Gene SJ09656 == * transcription-direction: ** negative * right-end-position: ** 25375 * left-end-position: ** 1753 * centisome-position: ** 4.631195 =...")
 
(7 intermediate revisions by 2 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-39 CPDQT-39] ==
+
== Gene SJ09656 ==
* common-name:
+
* transcription-direction:
** 3-[(6'-methylthio)hexyl]malate
+
** negative
* smiles:
+
* right-end-position:
** csccccccc(c(o)c(=o)[o-])c(=o)[o-]
+
** 25375
* inchi-key:
+
* left-end-position:
** lqqzhlhcfscjcu-uhfffaoysa-l
+
** 1753
* molecular-weight:
+
* centisome-position:
** 262.32
+
** 4.631195   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[RXN-18202]]
+
* [[S.japonica_carotenoid_curated]]
* [[RXNQT-4174]]
+
== Reaction(s) associated ==
== Reaction(s) known to produce the compound ==
+
* [[PROTEIN-KINASE-RXN]]
* [[RXN-18202]]
+
** Category: [[annotation]]
== Reaction(s) of unknown directionality ==
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: common-name=3-[(6'-methylthio)hexyl]malate}}
+
** Category: [[orthology]]
{{#set: inchi-key=inchikey=lqqzhlhcfscjcu-uhfffaoysa-l}}
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
{{#set: molecular-weight=262.32}}
+
* [[RNA-POLYMERASE-SUBUNIT-KINASE-RXN]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=25375}}
 +
{{#set: left-end-position=1753}}
 +
{{#set: centisome-position=4.631195    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=2}}

Latest revision as of 11:00, 18 March 2021

Gene SJ09656

  • transcription-direction:
    • negative
  • right-end-position:
    • 25375
  • left-end-position:
    • 1753
  • centisome-position:
    • 4.631195

Organism(s) associated with this gene

Reaction(s) associated