Difference between revisions of "SJ09705"

Revision as of 14:19, 26 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIMETHYL-D-RIBITYL-LUMAZINE DIMETHYL-D-RIBITYL-LUMAZINE] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Very-Long-Chain-oxoacyl-CoAs Very-Long-Chain-oxoacyl-CoAs] ==
 * common-name:
-** 6,7-dimethyl-8-(1-d-ribityl)lumazine
+** a very-long-chain oxoacyl-coa
-* smiles:
-** cc2(=c(c)n(cc(o)c(o)c(o)co)c1(c(c(=o)[n-]c(=o)n=1)=n2))
-* inchi-key:
-** sxdxrjzuajbnfl-xkssxdpksa-m
-* molecular-weight:
-** 325.3
 == Reaction(s) known to consume the compound ==
-* [[RIBOFLAVIN-SYN-RXN]]
+* [[RXN-7698]]
 == Reaction(s) known to produce the compound ==
-* [[LUMAZINESYN-RXN]]
+* [[RXN-7697]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=6,7-dimethyl-8-(1-d-ribityl)lumazine}}
+{{#set: common-name=a very-long-chain oxoacyl-coa}}
-{{#set: inchi-key=inchikey=sxdxrjzuajbnfl-xkssxdpksa-m}}
-{{#set: molecular-weight=325.3}}