Difference between revisions of "SJ09717"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14018 CPD-14018] == * common-name: ** icosapentaenoyl-coa * smiles: ** ccc=ccc=ccc=ccc=ccc=...")
(Created page with "Category:gene == Gene SJ09717 == * transcription-direction: ** positive * right-end-position: ** 41300 * left-end-position: ** 25956 * centisome-position: ** 3.1937826...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14018 CPD-14018] ==
+
== Gene SJ09717 ==
−
* common-name:
+
* transcription-direction:
−
** icosapentaenoyl-coa
+
** positive
−
* smiles:
+
* right-end-position:
−
** ccc=ccc=ccc=ccc=ccc=ccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** 41300
−
* inchi-key:
+
* left-end-position:
−
** jwzlrycddxhxdl-lcmhirpzsa-j
+
** 25956
−
* molecular-weight:
+
* centisome-position:
−
** 1047.943
+
** 3.1937826   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[RXN-13430]]
+
* [[S.japonica_carotenoid_curated]]
−
* [[RXN-17688]]
+
== Reaction(s) associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[2.7.13.3-RXN]]
−
* [[RXN-12978]]
+
** Category: [[annotation]]
−
* [[RXN-17688]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
== Reaction(s) of unknown directionality ==
+
* [[PROTEIN-KINASE-RXN]]
−
{{#set: common-name=icosapentaenoyl-coa}}
+
** Category: [[annotation]]
−
{{#set: inchi-key=inchikey=jwzlrycddxhxdl-lcmhirpzsa-j}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
{{#set: molecular-weight=1047.943}}
+
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=41300}}
 +
{{#set: left-end-position=25956}}
 +
{{#set: centisome-position=3.1937826    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=2}}

Latest revision as of 11:00, 18 March 2021

Gene SJ09717

  • transcription-direction:
    • positive
  • right-end-position:
    • 41300
  • left-end-position:
    • 25956
  • centisome-position:
    • 3.1937826

Organism(s) associated with this gene

Reaction(s) associated




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ09717&oldid=131730"