Difference between revisions of "SJ09717"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-2-hydroxyacids L-2-hydroxyacids] == * common-name: ** a (2s)-2-hydroxycarboxylate == Reaction...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14018 CPD-14018] == * common-name: ** icosapentaenoyl-coa * smiles: ** ccc=ccc=ccc=ccc=ccc=...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-2-hydroxyacids L-2-hydroxyacids] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14018 CPD-14018] ==
 
* common-name:
 
* common-name:
** a (2s)-2-hydroxycarboxylate
+
** icosapentaenoyl-coa
 +
* smiles:
 +
** ccc=ccc=ccc=ccc=ccc=ccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 +
* inchi-key:
 +
** jwzlrycddxhxdl-lcmhirpzsa-j
 +
* molecular-weight:
 +
** 1047.943
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13927]]
+
* [[RXN-13430]]
 +
* [[RXN-17688]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13927]]
+
* [[RXN-12978]]
 +
* [[RXN-17688]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a (2s)-2-hydroxycarboxylate}}
+
{{#set: common-name=icosapentaenoyl-coa}}
 +
{{#set: inchi-key=inchikey=jwzlrycddxhxdl-lcmhirpzsa-j}}
 +
{{#set: molecular-weight=1047.943}}

Revision as of 09:23, 27 August 2019

Metabolite CPD-14018

  • common-name:
    • icosapentaenoyl-coa
  • smiles:
    • ccc=ccc=ccc=ccc=ccc=ccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • jwzlrycddxhxdl-lcmhirpzsa-j
  • molecular-weight:
    • 1047.943

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality