Difference between revisions of "SJ09717"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14018 CPD-14018] == * common-name: ** icosapentaenoyl-coa * smiles: ** ccc=ccc=ccc=ccc=ccc=...")
(Created page with "Category:gene == Gene SJ09282 == * transcription-direction: ** positive * right-end-position: ** 281589 * left-end-position: ** 267360 * centisome-position: ** 63.561195...")
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14018 CPD-14018] ==
+
== Gene SJ09282 ==
−
* common-name:
+
* transcription-direction:
−
** icosapentaenoyl-coa
+
** positive
−
* smiles:
+
* right-end-position:
−
** ccc=ccc=ccc=ccc=ccc=ccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** 281589
−
* inchi-key:
+
* left-end-position:
−
** jwzlrycddxhxdl-lcmhirpzsa-j
+
** 267360
−
* molecular-weight:
+
* centisome-position:
−
** 1047.943
+
** 63.561195   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[RXN-13430]]
+
* [[S.japonica_sterols_curated]]
−
* [[RXN-17688]]
+
== Reaction(s) associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[PROTEIN-KINASE-RXN]]
−
* [[RXN-12978]]
+
** Category: [[annotation]]
−
* [[RXN-17688]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
== Reaction(s) of unknown directionality ==
+
** Category: [[orthology]]
−
{{#set: common-name=icosapentaenoyl-coa}}
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
−
{{#set: inchi-key=inchikey=jwzlrycddxhxdl-lcmhirpzsa-j}}
+
{{#set: transcription-direction=positive}}
−
{{#set: molecular-weight=1047.943}}
+
{{#set: right-end-position=281589}}
 +
{{#set: left-end-position=267360}}
 +
{{#set: centisome-position=63.561195    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=1}}

Revision as of 20:19, 18 December 2020

Gene SJ09282

  • transcription-direction:
    • positive
  • right-end-position:
    • 281589
  • left-end-position:
    • 267360
  • centisome-position:
    • 63.561195

Organism(s) associated with this gene

Reaction(s) associated




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ09717&oldid=40546"