Difference between revisions of "SJ09795"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-Phospho-terminated-DNAs 5-Phospho-terminated-DNAs] == * common-name: ** a 5'-phospho-[dna] ==...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1130 CPD-1130] == * common-name: ** 3-ethylmalate * smiles: ** ccc(c([o-])=o)c(c(=o)[o-])o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-Phospho-terminated-DNAs 5-Phospho-terminated-DNAs] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1130 CPD-1130] ==
 
* common-name:
 
* common-name:
** a 5'-phospho-[dna]
+
** 3-ethylmalate
 +
* smiles:
 +
** ccc(c([o-])=o)c(c(=o)[o-])o
 +
* inchi-key:
 +
** jucrenbzzqkfgk-uhfffaoysa-l
 +
* molecular-weight:
 +
** 160.126
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DNA-LIGASE-ATP-RXN]]
+
* [[RXN-14986]]
* [[DNA-LIGASE-NAD+-RXN]]
+
* [[RXN-18210]]
* [[RXN-15712]]
 
* [[RXN-15713]]
 
* [[RXN-17918]]
 
* [[RXN-17922]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[4.2.99.18-RXN]]
+
* [[RXN-18210]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a 5'-phospho-[dna]}}
+
{{#set: common-name=3-ethylmalate}}
 +
{{#set: inchi-key=inchikey=jucrenbzzqkfgk-uhfffaoysa-l}}
 +
{{#set: molecular-weight=160.126}}

Revision as of 14:19, 26 August 2019

Metabolite CPD-1130

  • common-name:
    • 3-ethylmalate
  • smiles:
    • ccc(c([o-])=o)c(c(=o)[o-])o
  • inchi-key:
    • jucrenbzzqkfgk-uhfffaoysa-l
  • molecular-weight:
    • 160.126

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality