Difference between revisions of "SJ09824"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8167 CPD-8167] == * common-name: ** 1-18:3-2-18:2-monogalactosyldiacylglycerol * smiles: **...")
 
(Created page with "Category:gene == Gene SJ09824 == * transcription-direction: ** negative * right-end-position: ** 28181 * left-end-position: ** 20602 * centisome-position: ** 56.77985...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8167 CPD-8167] ==
+
== Gene SJ09824 ==
−
* common-name:
+
* transcription-direction:
−
** 1-18:3-2-18:2-monogalactosyldiacylglycerol
+
** negative
−
* smiles:
+
* right-end-position:
−
** ccc=ccc=ccc=ccccccccc(occ(coc1(oc(co)c(o)c(o)c(o)1))oc(=o)cccccccc=ccc=cccccc)=o
+
** 28181
−
* inchi-key:
+
* left-end-position:
−
** ynsrhgcgbfcdgk-rouqbacdsa-n
+
** 20602
−
* molecular-weight:
+
* centisome-position:
−
** 777.089
+
** 56.77985   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
== Reaction(s) known to produce the compound ==
+
* [[S.japonica_carotenoid_curated]]
−
* [[RXN-8366]]
+
== Reaction(s) associated ==
−
== Reaction(s) of unknown directionality ==
+
* [[2.4.1.109-RXN]]
−
{{#set: common-name=1-18:3-2-18:2-monogalactosyldiacylglycerol}}
+
** Category: [[annotation]]
−
{{#set: inchi-key=inchikey=ynsrhgcgbfcdgk-rouqbacdsa-n}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
{{#set: molecular-weight=777.089}}
+
* [[2.4.1.83-RXN]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
** Category: [[orthology]]
 +
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
* [[RXN-16602]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
** Category: [[orthology]]
 +
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
== Pathway(s) associated ==
 +
* [[PWY-7921]]
 +
** '''2''' reactions found over '''7''' reactions in the full pathway
 +
* [[PWY-7922]]
 +
** '''2''' reactions found over '''5''' reactions in the full pathway
 +
* [[MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS]]
 +
** '''16''' reactions found over '''19''' reactions in the full pathway
 +
* [[PWY-7661]]
 +
** '''1''' reactions found over '''11''' reactions in the full pathway
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=28181}}
 +
{{#set: left-end-position=20602}}
 +
{{#set: centisome-position=56.77985    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=3}}
 +
{{#set: nb pathway associated=4}}

Latest revision as of 11:04, 18 March 2021

Gene SJ09824

  • transcription-direction:
    • negative
  • right-end-position:
    • 28181
  • left-end-position:
    • 20602
  • centisome-position:
    • 56.77985

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ09824&oldid=133291"