Difference between revisions of "SJ09824"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8167 CPD-8167] == * common-name: ** 1-18:3-2-18:2-monogalactosyldiacylglycerol * smiles: **...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Fe2-siderophores Fe2-siderophores] == * common-name: ** an fe(ii)-siderophore == Reaction(s) kn...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8167 CPD-8167] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Fe2-siderophores Fe2-siderophores] ==
 
* common-name:
 
* common-name:
** 1-18:3-2-18:2-monogalactosyldiacylglycerol
+
** an fe(ii)-siderophore
* smiles:
 
** ccc=ccc=ccc=ccccccccc(occ(coc1(oc(co)c(o)c(o)c(o)1))oc(=o)cccccccc=ccc=cccccc)=o
 
* inchi-key:
 
** ynsrhgcgbfcdgk-rouqbacdsa-n
 
* molecular-weight:
 
** 777.089
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8366]]
+
* [[FERRIC-CHELATE-REDUCTASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-18:3-2-18:2-monogalactosyldiacylglycerol}}
+
{{#set: common-name=an fe(ii)-siderophore}}
{{#set: inchi-key=inchikey=ynsrhgcgbfcdgk-rouqbacdsa-n}}
 
{{#set: molecular-weight=777.089}}
 

Revision as of 14:20, 26 August 2019

Metabolite Fe2-siderophores

  • common-name:
    • an fe(ii)-siderophore

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality