Difference between revisions of "SJ09885"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13397 CPD-13397] == * common-name: ** l-alanyl-l-threonine * smiles: ** cc([n+])c(=o)nc(c(o...")
(Created page with "Category:gene == Gene SJ01009 == * transcription-direction: ** positive * right-end-position: ** 81048 * left-end-position: ** 71004 * centisome-position: ** 44.793236...")
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13397 CPD-13397] ==
+
== Gene SJ01009 ==
−
* common-name:
+
* transcription-direction:
−
** l-alanyl-l-threonine
+
** positive
−
* smiles:
+
* right-end-position:
−
** cc([n+])c(=o)nc(c(o)c)c([o-])=o
+
** 81048
−
* inchi-key:
+
* left-end-position:
−
** buqichwnxbibog-lmvfsukvsa-n
+
** 71004
−
* molecular-weight:
+
* centisome-position:
−
** 190.199
+
** 44.793236   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[RXN0-6980]]
+
* [[S.japonica_sterols_curated]]
−
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
−
== Reaction(s) of unknown directionality ==
+
* [[2.7.10.1-RXN]]
−
{{#set: common-name=l-alanyl-l-threonine}}
+
** Category: [[annotation]]
−
{{#set: inchi-key=inchikey=buqichwnxbibog-lmvfsukvsa-n}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
{{#set: molecular-weight=190.199}}
+
* [[2.7.12.1-RXN]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
* [[PROTEIN-KINASE-RXN]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
* [[RXN-14906]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=81048}}
 +
{{#set: left-end-position=71004}}
 +
{{#set: centisome-position=44.793236    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=4}}

Revision as of 20:22, 18 December 2020

Gene SJ01009

  • transcription-direction:
    • positive
  • right-end-position:
    • 81048
  • left-end-position:
    • 71004
  • centisome-position:
    • 44.793236

Organism(s) associated with this gene

Reaction(s) associated




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ09885&oldid=42056"