Difference between revisions of "SJ09890"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-BETA-D-GLUCOSYLGLUCOSE 3-BETA-D-GLUCOSYLGLUCOSE] == * common-name: ** nigerose * smiles: ** c...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Linear-Malto-Oligosaccharides Linear-Malto-Oligosaccharides] == * common-name: ** a linear malt...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-BETA-D-GLUCOSYLGLUCOSE 3-BETA-D-GLUCOSYLGLUCOSE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Linear-Malto-Oligosaccharides Linear-Malto-Oligosaccharides] ==
 
* common-name:
 
* common-name:
** nigerose
+
** a linear malto-oligosaccharide
* smiles:
 
** c(o)c2(c(o)c(o)c(o)c(oc1(c(o)c(o)oc(co)c(o)1))o2)
 
* inchi-key:
 
** qigjyvcqydkydw-nsyytrpssa-n
 
* molecular-weight:
 
** 342.299
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-5395]]
+
* [[RXN-12392]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-12392]]
 +
* [[RXN-1825]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=nigerose}}
+
{{#set: common-name=a linear malto-oligosaccharide}}
{{#set: inchi-key=inchikey=qigjyvcqydkydw-nsyytrpssa-n}}
 
{{#set: molecular-weight=342.299}}
 

Revision as of 09:23, 27 August 2019

Metabolite Linear-Malto-Oligosaccharides

  • common-name:
    • a linear malto-oligosaccharide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality