Difference between revisions of "SJ09895"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Branched-chain-2-keto-acid-deHase Branched-chain-2-keto-acid-deHase] == * common-name: ** a bra...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-444 CPD-444] == * common-name: ** s-(methyl-5-thio-α-d-ribose 1-phosphate * smiles: *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Branched-chain-2-keto-acid-deHase Branched-chain-2-keto-acid-deHase] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-444 CPD-444] ==
 
* common-name:
 
* common-name:
** a branched-chain 2-keto acid dehydrogenase
+
** s-(methyl-5-thio-α-d-ribose 1-phosphate
 +
* smiles:
 +
** cscc1(oc(op([o-])(=o)[o-])c(c1o)o)
 +
* inchi-key:
 +
** jtfittqbrjdstl-kvtdhhqdsa-l
 +
* molecular-weight:
 +
** 258.182
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.7.11.4-RXN]]
+
* [[5.3.1.23-RXN]]
 +
* [[M5TRPI]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.7.11.4-RXN]]
+
* [[M5TAP]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a branched-chain 2-keto acid dehydrogenase}}
+
{{#set: common-name=s-(methyl-5-thio-α-d-ribose 1-phosphate}}
 +
{{#set: inchi-key=inchikey=jtfittqbrjdstl-kvtdhhqdsa-l}}
 +
{{#set: molecular-weight=258.182}}

Revision as of 09:23, 27 August 2019

Metabolite CPD-444

  • common-name:
    • s-(methyl-5-thio-α-d-ribose 1-phosphate
  • smiles:
    • cscc1(oc(op([o-])(=o)[o-])c(c1o)o)
  • inchi-key:
    • jtfittqbrjdstl-kvtdhhqdsa-l
  • molecular-weight:
    • 258.182

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality