Difference between revisions of "SJ09956"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-31 CPD-31] == * common-name: ** (r)-citramalate * smiles: ** cc(o)(c(=o)[o-])cc(=o)[o-] * i...") |
(Created page with "Category:gene == Gene SJ09956 == == Organism(s) associated with this gene == * S.japonica_sterols_curated == Reaction(s) associated == * PROTEIN-KINASE-RXN ** Cat...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:gene]] |
− | == | + | == Gene SJ09956 == |
− | + | == Organism(s) associated with this gene == | |
− | + | * [[S.japonica_sterols_curated]] | |
− | + | == Reaction(s) associated == | |
− | + | * [[PROTEIN-KINASE-RXN]] | |
− | + | ** Category: [[orthology]] | |
− | + | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a | |
− | + | {{#set: organism associated=S.japonica_sterols_curated}} | |
− | + | {{#set: nb reaction associated=1}} | |
− | = | ||
− | * [[ | ||
− | == Reaction(s) | ||
− | * [[ | ||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: |
Revision as of 20:20, 18 December 2020
Gene SJ09956
Organism(s) associated with this gene
Reaction(s) associated
- PROTEIN-KINASE-RXN
- Category: orthology
- source: output_pantograph_ectocarpus_siliculosus; tool: pantograph; comment: n.a
- Category: orthology